organic compounds
The title compound, C31H29N or PhCH2(Et)NC6H4CH=CHCH=CPh2, was synthesized by the Wittig-Horner reaction between 4-(N-benzyl-N-ethyl)aminobenzaldehyde and the phosphonate carbanion, derived from 1,1-diphenyl-3-chloropropylene and triethyl phosphite by the Arbuzov reaction. The butadiene fragment has a planar transoid conformation.
organic compounds
The title compound, C36H31N, was synthesized by the Wittig reaction of 1,1-diphenyl-3-cholopropylene and 4-[N,N-bis(4-methylphenyl)amino]benzaldehyde. The butadiene structure has a planar transoid conformation.
organic compounds
The title compound, C37H33N, was synthesized by the Wittig-Horner reaction of 4-(N,N-dibenzylamino)-2-methylbenzaldehyde and the phosphonate carbanion, derived from 1,1-diphenyl-3-chloropropylene and triethyl phosphite by the Arbuzov reaction. The butadiene fragment has a planar cisoid conformation, while the two benzyl fragments are almost parallel to each other, forming a dihedral angle of 9.8 (2)°.