Supporting information
Crystallographic Information File (CIF) https://doi.org/10.1107/S1600536807050775/sj2378sup1.cif | |
Structure factor file (CIF format) https://doi.org/10.1107/S1600536807050775/sj2378Isup2.hkl |
CCDC reference: 667204
A 1 ml toluene solution of 4-vinyl anisole (158 mg; 1.18 mmol) was added to a 1 ml toluene suspension of Cp2ZrHCl (302 mg, 1.17 mmol) at room temperature. The resulting solution was stirred for 30 min while it quickly turned from cloudy white to red. The reaction mixture was filtered to afford a clear dark red solution which was cooled to -30°C and filtered again. The solvent was removed in vacuo and a CDCl3 solution afforded red-orange crystals of quality suitable for X-ray determination (147 mg; 32% yield).
All H-atoms were placed at idealized positions and refined using a riding model with d(C—H) = 0.95 Å, Uiso=1.2Ueq (C) for aromatic 0.99 Å, Uiso = 1.2Ueq (C) for CH2, 0.98 Å, Uiso = 1.5Ueq (C) for CH3 atoms. The 4-methoxyphenethyl ligand was disordered over two positions with occupancies that refined to 0.56:0.44. In the final refinement the occupancies were fixed at 0.50.
In the complex Cp2ZrCl(CH2CH2-4-C6H4OMe) (1), the observed Zr—Cl bond length of 2.4508 (5) Å is consistent with the lengths observed in previously reported structures of Cp2ZrCl(R) complexes (average 2.445 Å) (Chirik et al., 1999; Lappert et al., 1997; Grimmond et al., 2000). The Zr—Csp3 distance was found to be 2.2816 (15) Å, which compares to the distance observed for the analogue Cp2ZrCl(cyclo-C5H9) (2.276 (5) Å) (Chirik et al., 1999) and the average C—C distance in the six-membered ring is 1.386 Å. The methoxy group is bent out of the plane formed by the adjacent aromatic carbons by 8.0 (6)° with C—O distances of 1.370 (5) Å and 1.430 (8) Å to C17 and C19, respectively. The 4-methoxyphenethyl ligand, was disordered over two positions, Fig. 1. A slight rotation of 7.7° around C12 shifts the position of the aryl moiety in the second disorder component, with the methoxy group rotated by 179.6°.
For related structures, see: Chirik et al. (1999); Grimmond et al. (2000); Lappert et al. (1997).
Data collection: APEX2 (Bruker, 2005); cell refinement: APEX2 (Bruker, 2005); data reduction: SAINT (Bruker, 2003); program(s) used to solve structure: SHELXS97 (Sheldrick, 1997); program(s) used to refine structure: SHELXL97 (Sheldrick, 1997); molecular graphics: SHELXTL (Bruker, 2001); software used to prepare material for publication: SHELXTL (Bruker, 2001).
[Zr(C5H5)2(C9H11O)Cl] | F(000) = 800 |
Mr = 392.03 | Dx = 1.498 Mg m−3 |
Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
Hall symbol: -P 2yn | Cell parameters from 7049 reflections |
a = 6.8095 (7) Å | θ = 2.6–28.1° |
b = 12.3823 (12) Å | µ = 0.79 mm−1 |
c = 20.645 (2) Å | T = 173 K |
β = 93.198 (1)° | Block, orange |
V = 1738.0 (3) Å3 | 0.04 × 0.03 × 0.03 mm |
Z = 4 |
Bruker SMART APEXII CCD diffractometer | 4215 independent reflections |
Radiation source: fine-focus sealed tube | 3945 reflections with I > 2σ(I) |
Graphite monochromator | Rint = 0.024 |
ω scans | θmax = 28.2°, θmin = 1.9° |
Absorption correction: multi-scan (SADABS; Sheldrick, 2004) | h = −8→8 |
Tmin = 0.879, Tmax = 0.977 | k = −16→16 |
21010 measured reflections | l = −27→27 |
Refinement on F2 | Primary atom site location: structure-invariant direct methods |
Least-squares matrix: full | Secondary atom site location: difference Fourier map |
R[F2 > 2σ(F2)] = 0.022 | Hydrogen site location: inferred from neighbouring sites |
wR(F2) = 0.059 | H-atom parameters constrained |
S = 1.06 | w = 1/[σ2(Fo2) + (0.027P)2 + 0.7941P] where P = (Fo2 + 2Fc2)/3 |
4215 reflections | (Δ/σ)max = 0.001 |
273 parameters | Δρmax = 0.43 e Å−3 |
32 restraints | Δρmin = −0.34 e Å−3 |
[Zr(C5H5)2(C9H11O)Cl] | V = 1738.0 (3) Å3 |
Mr = 392.03 | Z = 4 |
Monoclinic, P21/n | Mo Kα radiation |
a = 6.8095 (7) Å | µ = 0.79 mm−1 |
b = 12.3823 (12) Å | T = 173 K |
c = 20.645 (2) Å | 0.04 × 0.03 × 0.03 mm |
β = 93.198 (1)° |
Bruker SMART APEXII CCD diffractometer | 4215 independent reflections |
Absorption correction: multi-scan (SADABS; Sheldrick, 2004) | 3945 reflections with I > 2σ(I) |
Tmin = 0.879, Tmax = 0.977 | Rint = 0.024 |
21010 measured reflections |
R[F2 > 2σ(F2)] = 0.022 | 32 restraints |
wR(F2) = 0.059 | H-atom parameters constrained |
S = 1.06 | Δρmax = 0.43 e Å−3 |
4215 reflections | Δρmin = −0.34 e Å−3 |
273 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
x | y | z | Uiso*/Ueq | Occ. (<1) | |
Zr1 | 0.468663 (19) | 0.587021 (11) | 0.190854 (6) | 0.02628 (5) | |
Cl2 | 0.70826 (7) | 0.47764 (4) | 0.25495 (2) | 0.05049 (12) | |
C1 | 0.3455 (3) | 0.40828 (14) | 0.14762 (10) | 0.0497 (5) | |
H1 | 0.3594 | 0.3464 | 0.1746 | 0.060* | |
C2 | 0.1864 (3) | 0.47838 (17) | 0.14413 (9) | 0.0481 (4) | |
H2 | 0.0729 | 0.4729 | 0.1687 | 0.058* | |
C3 | 0.2207 (3) | 0.55795 (17) | 0.09870 (9) | 0.0483 (4) | |
H3 | 0.1350 | 0.6161 | 0.0868 | 0.058* | |
C4 | 0.4032 (3) | 0.53761 (16) | 0.07354 (8) | 0.0489 (5) | |
H4 | 0.4630 | 0.5792 | 0.0414 | 0.059* | |
C5 | 0.4828 (3) | 0.44500 (16) | 0.10407 (10) | 0.0498 (4) | |
H5 | 0.6064 | 0.4130 | 0.0967 | 0.060* | |
C6 | 0.3718 (3) | 0.64765 (16) | 0.30112 (9) | 0.0490 (4) | |
H6 | 0.3965 | 0.6011 | 0.3373 | 0.059* | |
C7 | 0.4989 (3) | 0.72725 (16) | 0.27985 (9) | 0.0445 (4) | |
H7 | 0.6258 | 0.7437 | 0.2987 | 0.053* | |
C8 | 0.4069 (3) | 0.77817 (14) | 0.22615 (9) | 0.0411 (4) | |
H8 | 0.4596 | 0.8359 | 0.2023 | 0.049* | |
C9 | 0.2244 (3) | 0.72982 (15) | 0.21356 (9) | 0.0422 (4) | |
H9 | 0.1314 | 0.7488 | 0.1795 | 0.051* | |
C10 | 0.2010 (3) | 0.64864 (16) | 0.25954 (10) | 0.0475 (4) | |
H10 | 0.0902 | 0.6026 | 0.2622 | 0.057* | |
C11 | 0.7008 (2) | 0.68241 (14) | 0.13947 (8) | 0.0381 (4) | |
H11A | 0.7863 | 0.7152 | 0.1745 | 0.046* | |
H11B | 0.7824 | 0.6276 | 0.1187 | 0.046* | |
C12 | 0.6661 (3) | 0.77161 (15) | 0.08869 (10) | 0.0462 (4) | |
H12A | 0.5509 | 0.7527 | 0.0595 | 0.055* | |
H12B | 0.6370 | 0.8403 | 0.1107 | 0.055* | |
C13 | 0.8621 (6) | 0.7152 (3) | −0.00156 (19) | 0.0355 (9) | 0.50 |
H13 | 0.7675 | 0.6596 | −0.0094 | 0.043* | 0.50 |
C14 | 0.8408 (19) | 0.7859 (12) | 0.0500 (6) | 0.036 (3) | 0.50 |
C15 | 0.9837 (9) | 0.8657 (5) | 0.0579 (3) | 0.0372 (12) | 0.50 |
H15 | 0.9716 | 0.9159 | 0.0923 | 0.045* | 0.50 |
C16 | 1.1410 (6) | 0.8770 (3) | 0.0198 (2) | 0.0313 (8) | 0.50 |
H16 | 1.2356 | 0.9325 | 0.0278 | 0.038* | 0.50 |
C17 | 1.1571 (6) | 0.8043 (4) | −0.0311 (2) | 0.0254 (8) | 0.50 |
C18 | 1.0171 (5) | 0.7236 (3) | −0.04151 (15) | 0.0328 (7) | 0.50 |
H18 | 1.0281 | 0.6741 | −0.0763 | 0.039* | 0.50 |
O1 | 1.3041 (3) | 0.8057 (2) | −0.07376 (12) | 0.0411 (5) | 0.50 |
C19 | 1.4382 (13) | 0.8946 (7) | −0.0718 (4) | 0.0430 (15) | 0.50 |
H19A | 1.3641 | 0.9625 | −0.0746 | 0.064* | 0.50 |
H19B | 1.5231 | 0.8896 | −0.1085 | 0.064* | 0.50 |
H19C | 1.5192 | 0.8927 | −0.0311 | 0.064* | 0.50 |
C13A | 0.9084 (7) | 0.7584 (4) | −0.0056 (2) | 0.0495 (11) | 0.50 |
H13A | 0.8288 | 0.7049 | −0.0271 | 0.059* | 0.50 |
C14A | 0.8482 (18) | 0.8024 (13) | 0.0515 (6) | 0.0327 (18) | 0.50 |
C15A | 0.9705 (8) | 0.8793 (5) | 0.0809 (3) | 0.0402 (12) | 0.50 |
H15A | 0.9313 | 0.9122 | 0.1197 | 0.048* | 0.50 |
C16A | 1.1438 (6) | 0.9102 (3) | 0.0572 (2) | 0.0478 (9) | 0.50 |
H16A | 1.2274 | 0.9600 | 0.0803 | 0.057* | 0.50 |
C17A | 1.1958 (7) | 0.8678 (4) | −0.0010 (2) | 0.0414 (11) | 0.50 |
C18A | 1.0815 (8) | 0.7900 (5) | −0.0326 (3) | 0.0488 (16) | 0.50 |
H18A | 1.1203 | 0.7587 | −0.0719 | 0.059* | 0.50 |
O1A | 1.3740 (4) | 0.9094 (2) | −0.02203 (14) | 0.0538 (7) | 0.50 |
C19A | 1.4326 (19) | 0.8715 (9) | −0.0808 (5) | 0.061 (3) | 0.50 |
H19D | 1.4171 | 0.7928 | −0.0825 | 0.091* | 0.50 |
H19E | 1.5710 | 0.8901 | −0.0855 | 0.091* | 0.50 |
H19F | 1.3514 | 0.9045 | −0.1162 | 0.091* | 0.50 |
U11 | U22 | U33 | U12 | U13 | U23 | |
Zr1 | 0.02377 (8) | 0.02842 (8) | 0.02714 (8) | 0.00189 (5) | 0.00585 (5) | 0.00335 (5) |
Cl2 | 0.0438 (2) | 0.0560 (3) | 0.0516 (3) | 0.0183 (2) | 0.00319 (19) | 0.0185 (2) |
C1 | 0.0717 (14) | 0.0336 (9) | 0.0441 (10) | −0.0136 (8) | 0.0070 (9) | −0.0004 (7) |
C2 | 0.0427 (9) | 0.0601 (12) | 0.0420 (9) | −0.0165 (9) | 0.0083 (7) | −0.0152 (8) |
C3 | 0.0528 (11) | 0.0543 (11) | 0.0364 (9) | 0.0034 (9) | −0.0093 (8) | −0.0098 (8) |
C4 | 0.0732 (13) | 0.0477 (10) | 0.0268 (8) | −0.0117 (9) | 0.0131 (8) | −0.0037 (7) |
C5 | 0.0550 (11) | 0.0429 (10) | 0.0530 (11) | 0.0026 (9) | 0.0172 (9) | −0.0154 (8) |
C6 | 0.0672 (12) | 0.0495 (10) | 0.0317 (8) | 0.0131 (9) | 0.0154 (8) | −0.0012 (7) |
C7 | 0.0359 (8) | 0.0531 (10) | 0.0440 (9) | 0.0009 (8) | −0.0028 (7) | −0.0168 (8) |
C8 | 0.0454 (9) | 0.0318 (8) | 0.0471 (9) | −0.0001 (7) | 0.0108 (7) | −0.0060 (7) |
C9 | 0.0347 (8) | 0.0442 (9) | 0.0474 (9) | 0.0124 (7) | −0.0010 (7) | −0.0114 (8) |
C10 | 0.0386 (9) | 0.0468 (10) | 0.0596 (11) | −0.0075 (8) | 0.0246 (8) | −0.0179 (9) |
C11 | 0.0266 (7) | 0.0433 (9) | 0.0453 (9) | 0.0009 (6) | 0.0086 (6) | 0.0112 (7) |
C12 | 0.0313 (8) | 0.0430 (9) | 0.0653 (12) | 0.0007 (7) | 0.0114 (8) | 0.0188 (9) |
C13 | 0.0319 (19) | 0.041 (2) | 0.0337 (17) | −0.0203 (16) | 0.0040 (13) | −0.0003 (17) |
C14 | 0.032 (4) | 0.035 (4) | 0.038 (4) | −0.007 (3) | −0.007 (3) | 0.014 (2) |
C15 | 0.045 (2) | 0.032 (2) | 0.036 (3) | 0.0011 (17) | 0.014 (2) | −0.006 (2) |
C16 | 0.034 (2) | 0.0268 (16) | 0.033 (3) | −0.0097 (15) | 0.0089 (16) | −0.0079 (17) |
C17 | 0.026 (2) | 0.0254 (16) | 0.0252 (16) | −0.0052 (17) | 0.0027 (17) | 0.0009 (13) |
C18 | 0.0356 (17) | 0.0353 (16) | 0.0279 (15) | −0.0214 (14) | 0.0042 (12) | −0.0070 (12) |
O1 | 0.0364 (12) | 0.0470 (13) | 0.0417 (12) | −0.0142 (11) | 0.0195 (10) | −0.0041 (10) |
C19 | 0.033 (2) | 0.048 (3) | 0.050 (3) | −0.015 (2) | 0.015 (2) | 0.010 (3) |
C13A | 0.048 (3) | 0.054 (3) | 0.046 (2) | −0.014 (2) | −0.010 (2) | 0.006 (2) |
C14A | 0.029 (4) | 0.034 (4) | 0.036 (4) | 0.003 (2) | 0.011 (2) | 0.011 (2) |
C15A | 0.038 (2) | 0.038 (3) | 0.046 (3) | −0.0049 (17) | 0.015 (2) | 0.000 (2) |
C16A | 0.045 (2) | 0.051 (2) | 0.049 (2) | −0.0112 (17) | 0.0115 (18) | −0.0041 (19) |
C17A | 0.043 (3) | 0.046 (2) | 0.036 (3) | 0.005 (2) | 0.0075 (18) | 0.007 (2) |
C18A | 0.046 (3) | 0.070 (4) | 0.031 (2) | 0.006 (3) | 0.004 (3) | 0.005 (2) |
O1A | 0.0480 (16) | 0.0639 (18) | 0.0509 (16) | −0.0081 (13) | 0.0136 (13) | 0.0004 (13) |
C19A | 0.060 (4) | 0.066 (5) | 0.057 (4) | 0.001 (3) | 0.013 (3) | −0.004 (3) |
Zr1—C11 | 2.2816 (15) | C12—C14 | 1.480 (9) |
Zr1—Cl2 | 2.4508 (5) | C12—C14A | 1.542 (8) |
Zr1—C9 | 2.4897 (16) | C12—H12A | 0.9900 |
Zr1—C10 | 2.4905 (16) | C12—H12B | 0.9900 |
Zr1—C2 | 2.4958 (18) | C13—C18 | 1.379 (4) |
Zr1—C3 | 2.4985 (18) | C13—C14 | 1.392 (6) |
Zr1—C1 | 2.5130 (18) | C13—H13 | 0.9500 |
Zr1—C4 | 2.5138 (17) | C14—C15 | 1.390 (6) |
Zr1—C5 | 2.5161 (18) | C15—C16 | 1.371 (5) |
Zr1—C8 | 2.5187 (17) | C15—H15 | 0.9500 |
Zr1—C6 | 2.5197 (17) | C16—C17 | 1.392 (5) |
Zr1—C7 | 2.5281 (17) | C16—H16 | 0.9500 |
C1—C2 | 1.387 (3) | C17—O1 | 1.370 (5) |
C1—C5 | 1.408 (3) | C17—C18 | 1.390 (4) |
C1—H1 | 0.9500 | C18—H18 | 0.9500 |
C2—C3 | 1.389 (3) | O1—C19 | 1.430 (8) |
C2—H2 | 0.9500 | C19—H19A | 0.9800 |
C3—C4 | 1.396 (3) | C19—H19B | 0.9800 |
C3—H3 | 0.9500 | C19—H19C | 0.9800 |
C4—C5 | 1.403 (3) | C13A—C14A | 1.382 (6) |
C4—H4 | 0.9500 | C13A—C18A | 1.387 (6) |
C5—H5 | 0.9500 | C13A—H13A | 0.9500 |
C6—C7 | 1.398 (3) | C14A—C15A | 1.383 (6) |
C6—C10 | 1.407 (3) | C15A—C16A | 1.357 (5) |
C6—H6 | 0.9500 | C15A—H15A | 0.9500 |
C7—C8 | 1.394 (3) | C16A—C17A | 1.375 (5) |
C7—H7 | 0.9500 | C16A—H16A | 0.9500 |
C8—C9 | 1.390 (3) | C17A—C18A | 1.379 (6) |
C8—H8 | 0.9500 | C17A—O1A | 1.409 (5) |
C9—C10 | 1.398 (3) | C18A—H18A | 0.9500 |
C9—H9 | 0.9500 | O1A—C19A | 1.382 (10) |
C10—H10 | 0.9500 | C19A—H19D | 0.9800 |
C11—C12 | 1.532 (2) | C19A—H19E | 0.9800 |
C11—H11A | 0.9900 | C19A—H19F | 0.9800 |
C11—H11B | 0.9900 | ||
C11—Zr1—Cl2 | 94.56 (4) | C4—C5—H5 | 126.4 |
C11—Zr1—C9 | 101.96 (6) | C1—C5—H5 | 126.4 |
Cl2—Zr1—C9 | 136.25 (4) | Zr1—C5—H5 | 118.3 |
C11—Zr1—C10 | 130.85 (6) | C7—C6—C10 | 107.89 (17) |
Cl2—Zr1—C10 | 110.37 (5) | C7—C6—Zr1 | 74.25 (10) |
C9—Zr1—C10 | 32.60 (7) | C10—C6—Zr1 | 72.56 (10) |
C11—Zr1—C2 | 129.64 (6) | C7—C6—H6 | 126.1 |
Cl2—Zr1—C2 | 112.71 (5) | C10—C6—H6 | 126.1 |
C9—Zr1—C2 | 86.98 (6) | Zr1—C6—H6 | 119.0 |
C10—Zr1—C2 | 79.21 (6) | C8—C7—C6 | 108.07 (16) |
C11—Zr1—C3 | 100.19 (7) | C8—C7—Zr1 | 73.60 (10) |
Cl2—Zr1—C3 | 137.12 (5) | C6—C7—Zr1 | 73.59 (10) |
C9—Zr1—C3 | 79.37 (6) | C8—C7—H7 | 126.0 |
C10—Zr1—C3 | 89.58 (7) | C6—C7—H7 | 126.0 |
C2—Zr1—C3 | 32.30 (7) | Zr1—C7—H7 | 118.7 |
C11—Zr1—C1 | 121.13 (7) | C9—C8—C7 | 108.14 (16) |
Cl2—Zr1—C1 | 84.49 (5) | C9—C8—Zr1 | 72.74 (10) |
C9—Zr1—C1 | 118.63 (7) | C7—C8—Zr1 | 74.34 (10) |
C10—Zr1—C1 | 103.40 (7) | C9—C8—H8 | 125.9 |
C2—Zr1—C1 | 32.15 (7) | C7—C8—H8 | 125.9 |
C3—Zr1—C1 | 53.46 (7) | Zr1—C8—H8 | 118.9 |
C11—Zr1—C4 | 76.60 (7) | C8—C9—C10 | 108.50 (16) |
Cl2—Zr1—C4 | 117.56 (5) | C8—C9—Zr1 | 75.03 (10) |
C9—Zr1—C4 | 105.65 (7) | C10—C9—Zr1 | 73.73 (10) |
C10—Zr1—C4 | 121.81 (7) | C8—C9—H9 | 125.7 |
C2—Zr1—C4 | 53.49 (6) | C10—C9—H9 | 125.7 |
C3—Zr1—C4 | 32.35 (7) | Zr1—C9—H9 | 117.4 |
C1—Zr1—C4 | 53.53 (6) | C9—C10—C6 | 107.40 (17) |
C11—Zr1—C5 | 88.61 (7) | C9—C10—Zr1 | 73.67 (10) |
Cl2—Zr1—C5 | 86.99 (5) | C6—C10—Zr1 | 74.84 (10) |
C9—Zr1—C5 | 133.07 (7) | C9—C10—H10 | 126.3 |
C10—Zr1—C5 | 132.67 (7) | C6—C10—H10 | 126.3 |
C2—Zr1—C5 | 53.65 (6) | Zr1—C10—H10 | 117.3 |
C3—Zr1—C5 | 53.71 (7) | C12—C11—Zr1 | 127.38 (11) |
C1—Zr1—C5 | 32.52 (7) | C12—C11—H11A | 105.5 |
C4—Zr1—C5 | 32.39 (7) | Zr1—C11—H11A | 105.5 |
C11—Zr1—C8 | 77.25 (6) | C12—C11—H11B | 105.5 |
Cl2—Zr1—C8 | 118.69 (5) | Zr1—C11—H11B | 105.5 |
C9—Zr1—C8 | 32.23 (6) | H11A—C11—H11B | 106.0 |
C10—Zr1—C8 | 53.71 (6) | C14—C12—C11 | 111.0 (8) |
C2—Zr1—C8 | 118.74 (7) | C11—C12—C14A | 114.9 (8) |
C3—Zr1—C8 | 103.82 (6) | C14—C12—H12A | 109.4 |
C1—Zr1—C8 | 150.75 (7) | C11—C12—H12A | 109.4 |
C4—Zr1—C8 | 118.94 (6) | C14A—C12—H12A | 112.8 |
C5—Zr1—C8 | 151.21 (7) | C14—C12—H12B | 109.4 |
C11—Zr1—C6 | 119.27 (7) | C11—C12—H12B | 109.4 |
Cl2—Zr1—C6 | 82.92 (5) | C14A—C12—H12B | 101.7 |
C9—Zr1—C6 | 53.63 (6) | H12A—C12—H12B | 108.0 |
C10—Zr1—C6 | 32.60 (7) | C18—C13—C14 | 121.7 (5) |
C2—Zr1—C6 | 105.96 (7) | C18—C13—H13 | 119.2 |
C3—Zr1—C6 | 122.08 (7) | C14—C13—H13 | 119.2 |
C1—Zr1—C6 | 118.97 (7) | C15—C14—C13 | 115.8 (7) |
C4—Zr1—C6 | 154.39 (7) | C15—C14—C12 | 126.8 (5) |
C5—Zr1—C6 | 150.92 (7) | C13—C14—C12 | 117.3 (6) |
C8—Zr1—C6 | 53.29 (6) | C16—C15—C14 | 124.6 (5) |
C11—Zr1—C7 | 87.24 (7) | C16—C15—H15 | 117.7 |
Cl2—Zr1—C7 | 87.85 (5) | C14—C15—H15 | 117.7 |
C9—Zr1—C7 | 53.38 (6) | C15—C16—C17 | 117.7 (4) |
C10—Zr1—C7 | 53.72 (6) | C15—C16—H16 | 121.2 |
C2—Zr1—C7 | 132.91 (6) | C17—C16—H16 | 121.2 |
C3—Zr1—C7 | 132.57 (6) | O1—C17—C18 | 115.4 (4) |
C1—Zr1—C7 | 151.06 (7) | O1—C17—C16 | 124.7 (4) |
C4—Zr1—C7 | 150.49 (7) | C18—C17—C16 | 119.9 (4) |
C5—Zr1—C7 | 173.10 (6) | C13—C18—C17 | 120.2 (3) |
C8—Zr1—C7 | 32.06 (6) | C13—C18—H18 | 119.9 |
C6—Zr1—C7 | 32.17 (7) | C17—C18—H18 | 119.9 |
C2—C1—C5 | 108.02 (17) | C17—O1—C19 | 118.7 (4) |
C2—C1—Zr1 | 73.24 (10) | C14A—C13A—C18A | 122.1 (5) |
C5—C1—Zr1 | 73.86 (10) | C14A—C13A—H13A | 119.0 |
C2—C1—H1 | 126.0 | C18A—C13A—H13A | 119.0 |
C5—C1—H1 | 126.0 | C13A—C14A—C15A | 116.5 (6) |
Zr1—C1—H1 | 118.8 | C13A—C14A—C12 | 127.8 (6) |
C1—C2—C3 | 108.57 (17) | C15A—C14A—C12 | 115.7 (5) |
C1—C2—Zr1 | 74.60 (11) | C16A—C15A—C14A | 123.3 (5) |
C3—C2—Zr1 | 73.96 (11) | C16A—C15A—H15A | 118.3 |
C1—C2—H2 | 125.7 | C14A—C15A—H15A | 118.3 |
C3—C2—H2 | 125.7 | C15A—C16A—C17A | 118.7 (4) |
Zr1—C2—H2 | 117.7 | C15A—C16A—H16A | 120.7 |
C2—C3—C4 | 108.06 (18) | C17A—C16A—H16A | 120.7 |
C2—C3—Zr1 | 73.74 (10) | C16A—C17A—C18A | 120.9 (4) |
C4—C3—Zr1 | 74.43 (11) | C16A—C17A—O1A | 113.4 (4) |
C2—C3—H3 | 126.0 | C18A—C17A—O1A | 125.7 (4) |
C4—C3—H3 | 126.0 | C17A—C18A—C13A | 118.5 (5) |
Zr1—C3—H3 | 117.8 | C17A—C18A—H18A | 120.8 |
C3—C4—C5 | 108.05 (17) | C13A—C18A—H18A | 120.8 |
C3—C4—Zr1 | 73.22 (10) | C19A—O1A—C17A | 116.3 (6) |
C5—C4—Zr1 | 73.90 (10) | O1A—C19A—H19D | 109.5 |
C3—C4—H4 | 126.0 | O1A—C19A—H19E | 109.5 |
C5—C4—H4 | 126.0 | H19D—C19A—H19E | 109.5 |
Zr1—C4—H4 | 118.8 | O1A—C19A—H19F | 109.5 |
C4—C5—C1 | 107.29 (18) | H19D—C19A—H19F | 109.5 |
C4—C5—Zr1 | 73.71 (10) | H19E—C19A—H19F | 109.5 |
C1—C5—Zr1 | 73.62 (10) | ||
C11—Zr1—C1—C2 | −116.08 (12) | C11—Zr1—C7—C8 | 70.15 (11) |
Cl2—Zr1—C1—C2 | 151.90 (11) | Cl2—Zr1—C7—C8 | 164.83 (10) |
C9—Zr1—C1—C2 | 11.17 (14) | C9—Zr1—C7—C8 | −36.96 (11) |
C10—Zr1—C1—C2 | 42.23 (13) | C10—Zr1—C7—C8 | −77.80 (12) |
C3—Zr1—C1—C2 | −37.06 (11) | C2—Zr1—C7—C8 | −75.67 (14) |
C4—Zr1—C1—C2 | −77.61 (13) | C3—Zr1—C7—C8 | −31.16 (15) |
C5—Zr1—C1—C2 | −115.06 (18) | C1—Zr1—C7—C8 | −120.63 (16) |
C8—Zr1—C1—C2 | 7.3 (2) | C4—Zr1—C7—C8 | 13.94 (19) |
C6—Zr1—C1—C2 | 73.14 (13) | C6—Zr1—C7—C8 | −115.07 (16) |
C7—Zr1—C1—C2 | 76.52 (18) | C11—Zr1—C7—C6 | −174.78 (12) |
C11—Zr1—C1—C5 | −1.03 (16) | Cl2—Zr1—C7—C6 | −80.10 (11) |
Cl2—Zr1—C1—C5 | −93.04 (13) | C9—Zr1—C7—C6 | 78.11 (12) |
C9—Zr1—C1—C5 | 126.23 (13) | C10—Zr1—C7—C6 | 37.27 (12) |
C10—Zr1—C1—C5 | 157.29 (13) | C2—Zr1—C7—C6 | 39.40 (15) |
C2—Zr1—C1—C5 | 115.06 (18) | C3—Zr1—C7—C6 | 83.90 (14) |
C3—Zr1—C1—C5 | 78.00 (14) | C1—Zr1—C7—C6 | −5.6 (2) |
C4—Zr1—C1—C5 | 37.45 (12) | C4—Zr1—C7—C6 | 129.01 (15) |
C8—Zr1—C1—C5 | 122.38 (15) | C8—Zr1—C7—C6 | 115.07 (16) |
C6—Zr1—C1—C5 | −171.80 (12) | C6—C7—C8—C9 | −0.6 (2) |
C7—Zr1—C1—C5 | −168.42 (13) | Zr1—C7—C8—C9 | 65.41 (12) |
C5—C1—C2—C3 | 0.5 (2) | C6—C7—C8—Zr1 | −66.06 (13) |
Zr1—C1—C2—C3 | 66.74 (13) | C11—Zr1—C8—C9 | 139.23 (12) |
C5—C1—C2—Zr1 | −66.22 (14) | Cl2—Zr1—C8—C9 | −132.54 (10) |
C11—Zr1—C2—C1 | 86.76 (14) | C10—Zr1—C8—C9 | −37.34 (11) |
Cl2—Zr1—C2—C1 | −30.54 (12) | C2—Zr1—C8—C9 | 10.78 (13) |
C9—Zr1—C2—C1 | −170.19 (12) | C3—Zr1—C8—C9 | 41.70 (12) |
C10—Zr1—C2—C1 | −138.27 (13) | C1—Zr1—C8—C9 | 6.34 (19) |
C3—Zr1—C2—C1 | 115.02 (17) | C4—Zr1—C8—C9 | 72.60 (13) |
C4—Zr1—C2—C1 | 77.77 (12) | C5—Zr1—C8—C9 | 76.84 (17) |
C5—Zr1—C2—C1 | 37.20 (11) | C6—Zr1—C8—C9 | −78.21 (12) |
C8—Zr1—C2—C1 | −175.93 (11) | C7—Zr1—C8—C9 | −115.19 (16) |
C6—Zr1—C2—C1 | −119.44 (12) | C11—Zr1—C8—C7 | −105.58 (11) |
C7—Zr1—C2—C1 | −140.02 (12) | Cl2—Zr1—C8—C7 | −17.35 (12) |
C11—Zr1—C2—C3 | −28.26 (15) | C9—Zr1—C8—C7 | 115.19 (16) |
Cl2—Zr1—C2—C3 | −145.56 (11) | C10—Zr1—C8—C7 | 77.85 (12) |
C9—Zr1—C2—C3 | 74.79 (12) | C2—Zr1—C8—C7 | 125.97 (11) |
C10—Zr1—C2—C3 | 106.71 (13) | C3—Zr1—C8—C7 | 156.89 (11) |
C1—Zr1—C2—C3 | −115.02 (17) | C1—Zr1—C8—C7 | 121.53 (14) |
C4—Zr1—C2—C3 | −37.25 (12) | C4—Zr1—C8—C7 | −172.21 (11) |
C5—Zr1—C2—C3 | −77.82 (13) | C5—Zr1—C8—C7 | −167.97 (13) |
C8—Zr1—C2—C3 | 69.05 (13) | C6—Zr1—C8—C7 | 36.98 (11) |
C6—Zr1—C2—C3 | 125.54 (12) | C7—C8—C9—C10 | 0.25 (19) |
C7—Zr1—C2—C3 | 104.96 (13) | Zr1—C8—C9—C10 | 66.72 (12) |
C1—C2—C3—C4 | −0.1 (2) | C7—C8—C9—Zr1 | −66.47 (12) |
Zr1—C2—C3—C4 | 67.09 (13) | C11—Zr1—C9—C8 | −40.62 (12) |
C1—C2—C3—Zr1 | −67.17 (13) | Cl2—Zr1—C9—C8 | 69.19 (13) |
C11—Zr1—C3—C2 | 158.26 (12) | C10—Zr1—C9—C8 | 114.85 (16) |
Cl2—Zr1—C3—C2 | 50.06 (14) | C2—Zr1—C9—C8 | −170.55 (12) |
C9—Zr1—C3—C2 | −101.35 (13) | C3—Zr1—C9—C8 | −138.91 (12) |
C10—Zr1—C3—C2 | −70.20 (12) | C1—Zr1—C9—C8 | −176.48 (11) |
C1—Zr1—C3—C2 | 36.89 (12) | C4—Zr1—C9—C8 | −119.86 (11) |
C4—Zr1—C3—C2 | 114.62 (18) | C5—Zr1—C9—C8 | −140.06 (11) |
C5—Zr1—C3—C2 | 77.61 (13) | C6—Zr1—C9—C8 | 77.07 (12) |
C8—Zr1—C3—C2 | −122.51 (12) | C7—Zr1—C9—C8 | 36.76 (11) |
C6—Zr1—C3—C2 | −67.41 (14) | C11—Zr1—C9—C10 | −155.46 (11) |
C7—Zr1—C3—C2 | −106.08 (13) | Cl2—Zr1—C9—C10 | −45.66 (13) |
C11—Zr1—C3—C4 | 43.64 (13) | C2—Zr1—C9—C10 | 74.61 (12) |
Cl2—Zr1—C3—C4 | −64.56 (14) | C3—Zr1—C9—C10 | 106.25 (12) |
C9—Zr1—C3—C4 | 144.04 (13) | C1—Zr1—C9—C10 | 68.68 (12) |
C10—Zr1—C3—C4 | 175.19 (13) | C4—Zr1—C9—C10 | 125.29 (11) |
C2—Zr1—C3—C4 | −114.62 (18) | C5—Zr1—C9—C10 | 105.09 (13) |
C1—Zr1—C3—C4 | −77.73 (13) | C8—Zr1—C9—C10 | −114.85 (16) |
C5—Zr1—C3—C4 | −37.01 (12) | C6—Zr1—C9—C10 | −37.78 (11) |
C8—Zr1—C3—C4 | 122.88 (12) | C7—Zr1—C9—C10 | −78.09 (12) |
C6—Zr1—C3—C4 | 177.97 (11) | C8—C9—C10—C6 | 0.24 (19) |
C7—Zr1—C3—C4 | 139.31 (12) | Zr1—C9—C10—C6 | 67.83 (12) |
C2—C3—C4—C5 | −0.4 (2) | C8—C9—C10—Zr1 | −67.58 (12) |
Zr1—C3—C4—C5 | 66.24 (14) | C7—C6—C10—C9 | −0.6 (2) |
C2—C3—C4—Zr1 | −66.64 (13) | Zr1—C6—C10—C9 | −67.03 (12) |
C11—Zr1—C4—C3 | −135.71 (13) | C7—C6—C10—Zr1 | 66.39 (12) |
Cl2—Zr1—C4—C3 | 136.12 (11) | C11—Zr1—C10—C9 | 32.48 (15) |
C9—Zr1—C4—C3 | −36.83 (13) | Cl2—Zr1—C10—C9 | 148.16 (10) |
C10—Zr1—C4—C3 | −5.67 (15) | C2—Zr1—C10—C9 | −101.45 (12) |
C2—Zr1—C4—C3 | 37.18 (12) | C3—Zr1—C10—C9 | −70.67 (12) |
C1—Zr1—C4—C3 | 77.48 (13) | C1—Zr1—C10—C9 | −122.80 (11) |
C5—Zr1—C4—C3 | 115.08 (18) | C4—Zr1—C10—C9 | −67.64 (12) |
C8—Zr1—C4—C3 | −68.73 (13) | C5—Zr1—C10—C9 | −106.41 (12) |
C6—Zr1—C4—C3 | −4.0 (2) | C8—Zr1—C10—C9 | 36.90 (10) |
C7—Zr1—C4—C3 | −77.13 (17) | C6—Zr1—C10—C9 | 113.72 (16) |
C11—Zr1—C4—C5 | 109.21 (13) | C7—Zr1—C10—C9 | 76.96 (12) |
Cl2—Zr1—C4—C5 | 21.04 (13) | C11—Zr1—C10—C6 | −81.23 (14) |
C9—Zr1—C4—C5 | −151.91 (12) | Cl2—Zr1—C10—C6 | 34.44 (12) |
C10—Zr1—C4—C5 | −120.75 (13) | C9—Zr1—C10—C6 | −113.72 (16) |
C2—Zr1—C4—C5 | −77.90 (13) | C2—Zr1—C10—C6 | 144.83 (13) |
C3—Zr1—C4—C5 | −115.08 (18) | C3—Zr1—C10—C6 | 175.62 (13) |
C1—Zr1—C4—C5 | −37.60 (12) | C1—Zr1—C10—C6 | 123.48 (12) |
C8—Zr1—C4—C5 | 176.19 (11) | C4—Zr1—C10—C6 | 178.65 (11) |
C6—Zr1—C4—C5 | −119.06 (17) | C5—Zr1—C10—C6 | 139.88 (12) |
C7—Zr1—C4—C5 | 167.79 (12) | C8—Zr1—C10—C6 | −76.82 (12) |
C3—C4—C5—C1 | 0.7 (2) | C7—Zr1—C10—C6 | −36.75 (11) |
Zr1—C4—C5—C1 | 66.51 (14) | Cl2—Zr1—C11—C12 | 179.89 (16) |
C3—C4—C5—Zr1 | −65.79 (13) | C9—Zr1—C11—C12 | −40.86 (18) |
C2—C1—C5—C4 | −0.8 (2) | C10—Zr1—C11—C12 | −58.06 (19) |
Zr1—C1—C5—C4 | −66.57 (13) | C2—Zr1—C11—C12 | 55.21 (19) |
C2—C1—C5—Zr1 | 65.81 (13) | C3—Zr1—C11—C12 | 40.31 (18) |
C11—Zr1—C5—C4 | −66.77 (12) | C1—Zr1—C11—C12 | 93.57 (17) |
Cl2—Zr1—C5—C4 | −161.41 (12) | C4—Zr1—C11—C12 | 62.62 (17) |
C9—Zr1—C5—C4 | 38.37 (16) | C5—Zr1—C11—C12 | 93.02 (17) |
C10—Zr1—C5—C4 | 83.40 (15) | C8—Zr1—C11—C12 | −61.71 (17) |
C2—Zr1—C5—C4 | 77.35 (13) | C6—Zr1—C11—C12 | −95.68 (17) |
C3—Zr1—C5—C4 | 36.96 (12) | C7—Zr1—C11—C12 | −92.50 (17) |
C1—Zr1—C5—C4 | 114.11 (19) | Zr1—C11—C12—C14 | −159.3 (3) |
C8—Zr1—C5—C4 | −6.9 (2) | Zr1—C11—C12—C14A | −166.5 (3) |
C6—Zr1—C5—C4 | 128.99 (15) | C18—C13—C14—C15 | 1 (2) |
C11—Zr1—C5—C1 | 179.12 (13) | C18—C13—C14—C12 | 178.3 (9) |
Cl2—Zr1—C5—C1 | 84.48 (13) | C11—C12—C14—C15 | −100.5 (17) |
C9—Zr1—C5—C1 | −75.75 (16) | C14A—C12—C14—C15 | 22 (9) |
C10—Zr1—C5—C1 | −30.72 (17) | C11—C12—C14—C13 | 82.1 (14) |
C2—Zr1—C5—C1 | −36.77 (13) | C14A—C12—C14—C13 | −156 (12) |
C3—Zr1—C5—C1 | −77.15 (14) | C13—C14—C15—C16 | −1 (2) |
C4—Zr1—C5—C1 | −114.11 (19) | C12—C14—C15—C16 | −178.5 (11) |
C8—Zr1—C5—C1 | −121.05 (15) | C14—C15—C16—C17 | 0.9 (14) |
C6—Zr1—C5—C1 | 14.9 (2) | C15—C16—C17—O1 | 179.3 (5) |
C11—Zr1—C6—C7 | 5.98 (14) | C15—C16—C17—C18 | −0.3 (7) |
Cl2—Zr1—C6—C7 | 97.26 (11) | C14—C13—C18—C17 | −0.1 (12) |
C9—Zr1—C6—C7 | −77.26 (12) | O1—C17—C18—C13 | −179.7 (4) |
C10—Zr1—C6—C7 | −115.04 (17) | C16—C17—C18—C13 | −0.1 (7) |
C2—Zr1—C6—C7 | −151.08 (12) | C18—C17—O1—C19 | 171.6 (6) |
C3—Zr1—C6—C7 | −120.21 (12) | C16—C17—O1—C19 | −8.0 (8) |
C1—Zr1—C6—C7 | 176.93 (11) | C18A—C13A—C14A—C15A | 0 (2) |
C4—Zr1—C6—C7 | −117.70 (16) | C18A—C13A—C14A—C12 | −176.8 (12) |
C5—Zr1—C6—C7 | 167.85 (13) | C14—C12—C14A—C13A | 29 (9) |
C8—Zr1—C6—C7 | −36.85 (11) | C11—C12—C14A—C13A | 90.0 (18) |
C11—Zr1—C6—C10 | 121.02 (12) | C14—C12—C14A—C15A | −147 (12) |
Cl2—Zr1—C6—C10 | −147.71 (12) | C11—C12—C14A—C15A | −86.3 (15) |
C9—Zr1—C6—C10 | 37.78 (11) | C13A—C14A—C15A—C16A | −2 (2) |
C2—Zr1—C6—C10 | −36.05 (13) | C12—C14A—C15A—C16A | 175.2 (9) |
C3—Zr1—C6—C10 | −5.18 (15) | C14A—C15A—C16A—C17A | 4.0 (14) |
C1—Zr1—C6—C10 | −68.04 (14) | C15A—C16A—C17A—C18A | −4.4 (8) |
C4—Zr1—C6—C10 | −2.7 (2) | C15A—C16A—C17A—O1A | 177.3 (5) |
C5—Zr1—C6—C10 | −77.11 (18) | C16A—C17A—C18A—C13A | 2.5 (8) |
C8—Zr1—C6—C10 | 78.19 (12) | O1A—C17A—C18A—C13A | −179.4 (5) |
C7—Zr1—C6—C10 | 115.04 (17) | C14A—C13A—C18A—C17A | 0.0 (14) |
C10—C6—C7—C8 | 0.8 (2) | C16A—C17A—O1A—C19A | −178.9 (7) |
Zr1—C6—C7—C8 | 66.07 (12) | C18A—C17A—O1A—C19A | 3.0 (9) |
C10—C6—C7—Zr1 | −65.27 (12) |
Experimental details
Crystal data | |
Chemical formula | [Zr(C5H5)2(C9H11O)Cl] |
Mr | 392.03 |
Crystal system, space group | Monoclinic, P21/n |
Temperature (K) | 173 |
a, b, c (Å) | 6.8095 (7), 12.3823 (12), 20.645 (2) |
β (°) | 93.198 (1) |
V (Å3) | 1738.0 (3) |
Z | 4 |
Radiation type | Mo Kα |
µ (mm−1) | 0.79 |
Crystal size (mm) | 0.04 × 0.03 × 0.03 |
Data collection | |
Diffractometer | Bruker SMART APEXII CCD |
Absorption correction | Multi-scan (SADABS; Sheldrick, 2004) |
Tmin, Tmax | 0.879, 0.977 |
No. of measured, independent and observed [I > 2σ(I)] reflections | 21010, 4215, 3945 |
Rint | 0.024 |
(sin θ/λ)max (Å−1) | 0.664 |
Refinement | |
R[F2 > 2σ(F2)], wR(F2), S | 0.022, 0.059, 1.06 |
No. of reflections | 4215 |
No. of parameters | 273 |
No. of restraints | 32 |
H-atom treatment | H-atom parameters constrained |
Δρmax, Δρmin (e Å−3) | 0.43, −0.34 |
Computer programs: APEX2 (Bruker, 2005), SAINT (Bruker, 2003), SHELXS97 (Sheldrick, 1997), SHELXL97 (Sheldrick, 1997), SHELXTL (Bruker, 2001).
In the complex Cp2ZrCl(CH2CH2-4-C6H4OMe) (1), the observed Zr—Cl bond length of 2.4508 (5) Å is consistent with the lengths observed in previously reported structures of Cp2ZrCl(R) complexes (average 2.445 Å) (Chirik et al., 1999; Lappert et al., 1997; Grimmond et al., 2000). The Zr—Csp3 distance was found to be 2.2816 (15) Å, which compares to the distance observed for the analogue Cp2ZrCl(cyclo-C5H9) (2.276 (5) Å) (Chirik et al., 1999) and the average C—C distance in the six-membered ring is 1.386 Å. The methoxy group is bent out of the plane formed by the adjacent aromatic carbons by 8.0 (6)° with C—O distances of 1.370 (5) Å and 1.430 (8) Å to C17 and C19, respectively. The 4-methoxyphenethyl ligand, was disordered over two positions, Fig. 1. A slight rotation of 7.7° around C12 shifts the position of the aryl moiety in the second disorder component, with the methoxy group rotated by 179.6°.